Products 278610-25-6

CAS 278610-25-6 is the registry number for 3-([(4-Chlorophenyl)amino]carbonyl)pyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[(4-chlorophenyl)carbamoyl]pyrazine-2-carboxylic acid (CAS 278610-25-6) is a chemical compound with the molecular formula C12H8ClN3O3 and a molecular weight of 277.66 g/mol. IUPAC name: 3-[(4-chlorophenyl)carbamoyl]pyrazine-2-carboxylic acid. InChIKey: AIOFVFFUYDYVPN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClN3O3
Molecular weight277.66 g/mol
IUPAC name3-[(4-chlorophenyl)carbamoyl]pyrazine-2-carboxylic acid
InChIKeyAIOFVFFUYDYVPN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)C2=NC=CN=C2C(=O)O)Cl

Computed by PubChem (NCBI)