CAS 10280-01-0 is the registry number for Inosine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 10280-01-0) is a chemical compound with the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. IUPAC name: 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: MTBCDJLBNPJBFZ-KQYNXXCUSA-N.
| Molecular formula | C10H12N4O5 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | MTBCDJLBNPJBFZ-KQYNXXCUSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)