CAS 52678-79-2 is the registry number for Inosine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
9-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-purin-6-one (CAS 52678-79-2) is a chemical compound with the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. IUPAC name: 9-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-purin-6-one. InChIKey: UKUBRHKAZHFGHP-KQYNXXCUSA-N.
| Molecular formula | C10H12N4O5 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 9-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1H-purin-6-one |
| InChIKey | UKUBRHKAZHFGHP-KQYNXXCUSA-N |
| SMILES | C1[C@H]([C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CNC3=O)O)O)O |
Computed by PubChem (NCBI)