Products 29049-22-7
CAS 29049-22-7 appears in our catalog under these names: 2'-Deoxyxanthosine, >95% (HPLC), 2'–Deoxyxanthosine, 2'-Deoxyxanthosine. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 2,5mg, 25mg, 5mg, 1mg, 100mg, 50mg, 250mg, 500mg.
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione (CAS 29049-22-7) is a chemical compound with the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. IUPAC name: 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione. InChIKey: NQAZHXBSLFDVKM-KVQBGUIXSA-N.
| Molecular formula | C10H12N4O5 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
| InChIKey | NQAZHXBSLFDVKM-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2NC(=O)NC3=O)CO)O |
Computed by PubChem (NCBI)