CAS 1028067-91-5 appears in our catalog under these names: ([(1-Acetyl-2,3-dihydro-1h-indol-5-yl)sulfonyl]amino)(phenyl)acetic acid, 95%, 2-(1-Acetylindoline-5-sulfonamido)-2-phenylacetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-2-phenylacetic acid (CAS 1028067-91-5) is a chemical compound with the molecular formula C18H18N2O5S and a molecular weight of 374.4 g/mol. IUPAC name: 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-2-phenylacetic acid. InChIKey: XDPBBCWFSQYXFT-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O5S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-2-phenylacetic acid |
| InChIKey | XDPBBCWFSQYXFT-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)NC(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)