CAS 468099-22-1 is the registry number for 4-((4-(N-(2,4-Dimethylphenyl)sulfamoyl)phenyl)amino)-4-oxobut-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[4-[(2,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid (CAS 468099-22-1) is a chemical compound with the molecular formula C18H18N2O5S and a molecular weight of 374.4 g/mol. IUPAC name: (E)-4-[4-[(2,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid. InChIKey: HIALGPJMAPWDIS-MDZDMXLPSA-N.
| Molecular formula | C18H18N2O5S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (E)-4-[4-[(2,4-dimethylphenyl)sulfamoyl]anilino]-4-oxobut-2-enoic acid |
| InChIKey | HIALGPJMAPWDIS-MDZDMXLPSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)