CAS 447411-92-9 is the registry number for 3-[(4-Benzoylpiperazin-1-yl)sulfonyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid (CAS 447411-92-9) is a chemical compound with the molecular formula C18H18N2O5S and a molecular weight of 374.4 g/mol. IUPAC name: 3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: MAKXWEYYRGLODM-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O5S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | MAKXWEYYRGLODM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=CC=C2)S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)