Products 447411-92-9

CAS 447411-92-9 is the registry number for 3-[(4-Benzoylpiperazin-1-yl)sulfonyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid (CAS 447411-92-9) is a chemical compound with the molecular formula C18H18N2O5S and a molecular weight of 374.4 g/mol. IUPAC name: 3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: MAKXWEYYRGLODM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O5S
Molecular weight374.4 g/mol
IUPAC name3-(4-benzoylpiperazin-1-yl)sulfonylbenzoic acid
InChIKeyMAKXWEYYRGLODM-UHFFFAOYSA-N
SMILESC1CN(CCN1C(=O)C2=CC=CC=C2)S(=O)(=O)C3=CC=CC(=C3)C(=O)O

Computed by PubChem (NCBI)