CAS 102811-39-2 appears in our catalog under these names: Ginkgolic acid 17:2, Ginkgolic Acid C17:2, (E/Z)–Ginkgolic acid C17:2, Ginkgolic Acid 17:2, 99.78% ,, 99.78% ,, (E/Z)-Ginkgolic acid C17:2, 99.37%. Offered by: Hubei YoungXin, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 20mg, 5mg, 1mg.
2-[(8E,11E)-heptadeca-8,11-dienyl]-6-hydroxybenzoic acid (CAS 102811-39-2) is a chemical compound with the molecular formula C24H36O3 and a molecular weight of 372.5 g/mol. IUPAC name: 2-[(8E,11E)-heptadeca-8,11-dienyl]-6-hydroxybenzoic acid. InChIKey: OFFQPVDOVYHTBX-AVQMFFATSA-N.
| Molecular formula | C24H36O3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 2-[(8E,11E)-heptadeca-8,11-dienyl]-6-hydroxybenzoic acid |
| InChIKey | OFFQPVDOVYHTBX-AVQMFFATSA-N |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC1=C(C(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)