Products 51022-71-0
CAS 51022-71-0 appears in our catalog under these names: Nabilone, Nabilone (1.0 mg/mL in Acetonitrile). Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 5x1ml, 1mg, 2mg, 10mg.
(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one (CAS 51022-71-0) is a chemical compound with the molecular formula C24H36O3 and a molecular weight of 372.5 g/mol. IUPAC name: (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one. InChIKey: GECBBEABIDMGGL-RTBURBONSA-N.
| Molecular formula | C24H36O3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
| InChIKey | GECBBEABIDMGGL-RTBURBONSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=C2[C@@H]3CC(=O)CC[C@H]3C(OC2=C1)(C)C)O |
Computed by PubChem (NCBI)