Products 56469-15-9
CAS 56469-15-9 appears in our catalog under these names: cis-Nabilone, cis-Nabilone (1.0mg/ml in Acetonitrile). Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 5x1ml, 250mg, 100mg, 500mg, 1000mg.
(6aS,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one (CAS 56469-15-9) is a chemical compound with the molecular formula C24H36O3 and a molecular weight of 372.5 g/mol. IUPAC name: (6aS,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one. InChIKey: GECBBEABIDMGGL-MOPGFXCFSA-N.
| Molecular formula | C24H36O3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | (6aS,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
| InChIKey | GECBBEABIDMGGL-MOPGFXCFSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=C2[C@@H]3CC(=O)CC[C@@H]3C(OC2=C1)(C)C)O |
Computed by PubChem (NCBI)