CAS 102872-45-7 appears in our catalog under these names: 1,2-Dimethyl-1h-benzoimidazol-5-ylamine dihydrochloride, 95%, 1,2–dimethyl–1H–1,3–benzodiazol–5–amine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g.
1,2-dimethylbenzimidazol-5-amine;dihydrochloride (CAS 102872-45-7) is a chemical compound with the molecular formula C9H13Cl2N3 and a molecular weight of 234.12 g/mol. IUPAC name: 1,2-dimethylbenzimidazol-5-amine;dihydrochloride. InChIKey: FFZFDNDRQGVKJN-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3 |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 1,2-dimethylbenzimidazol-5-amine;dihydrochloride |
| InChIKey | FFZFDNDRQGVKJN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)