Products 1269105-94-3
CAS 1269105-94-3 appears in our catalog under these names: 4,5-Dimethyl-1h-benzimidazol-6-amine dihydrochloride, 95%, 4,5-Dimethyl-1H-benzimidazol-6-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 5g, 1g.
6,7-dimethyl-3H-benzimidazol-5-amine;dihydrochloride (CAS 1269105-94-3) is a chemical compound with the molecular formula C9H13Cl2N3 and a molecular weight of 234.12 g/mol. IUPAC name: 6,7-dimethyl-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: WMJDYZOFQGPVRJ-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3 |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 6,7-dimethyl-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | WMJDYZOFQGPVRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1N)NC=N2)C.Cl.Cl |
Computed by PubChem (NCBI)