CAS 109386-04-1 is the registry number for (1-Methyl-1h-indazol-3-yl)methylamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(1-methylindazol-3-yl)methanamine;dihydrochloride (CAS 109386-04-1) is a chemical compound with the molecular formula C9H13Cl2N3 and a molecular weight of 234.12 g/mol. IUPAC name: (1-methylindazol-3-yl)methanamine;dihydrochloride. InChIKey: ZHWICCCSNYFLJY-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3 |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | (1-methylindazol-3-yl)methanamine;dihydrochloride |
| InChIKey | ZHWICCCSNYFLJY-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)