CAS 102877-77-0 is the registry number for 3-(Pyridin-4-yloxy)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-pyridin-4-yloxyaniline (CAS 102877-77-0) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 3-pyridin-4-yloxyaniline. InChIKey: CMKRVXYQYUODSA-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 3-pyridin-4-yloxyaniline |
| InChIKey | CMKRVXYQYUODSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=NC=C2)N |
Computed by PubChem (NCBI)