CAS 1029134-50-6 is the registry number for 6-Chloro-2,3-dihydro-4h-thiochromen-4-one oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(NE)-N-(6-chloro-2,3-dihydrothiochromen-4-ylidene)hydroxylamine (CAS 1029134-50-6) is a chemical compound with the molecular formula C9H8ClNOS and a molecular weight of 213.68 g/mol. IUPAC name: (NE)-N-(6-chloro-2,3-dihydrothiochromen-4-ylidene)hydroxylamine. InChIKey: APSUJQIKHWGVBW-DHZHZOJOSA-N.
| Molecular formula | C9H8ClNOS |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | (NE)-N-(6-chloro-2,3-dihydrothiochromen-4-ylidene)hydroxylamine |
| InChIKey | APSUJQIKHWGVBW-DHZHZOJOSA-N |
| SMILES | C\1CSC2=C(/C1=N/O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)