CAS 202595-63-9 appears in our catalog under these names: 4-(Chloromethyl)-5-methyl-2-thien-2-yl-1,3-oxazole, 95%, 4–(Chloromethyl)–5–methyl–2–(thiophen–2–yl)oxazole, 4-(chloromethyl)-5-methyl-2-(thiophen-2-yl)-1,3-oxazole. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 2,5g.
4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole (CAS 202595-63-9) is a chemical compound with the molecular formula C9H8ClNOS and a molecular weight of 213.68 g/mol. IUPAC name: 4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole. InChIKey: PLUQESCJPNWDFO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNOS |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 4-(chloromethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
| InChIKey | PLUQESCJPNWDFO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CS2)CCl |
Computed by PubChem (NCBI)