CAS 1315365-71-9 appears in our catalog under these names: 1-(5-Chloro-1,3-benzothiazol-2-yl)ethan-1-ol, 95%, 1-(5-Chloro-1,3-benzothiazol-2-yl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(5-chloro-1,3-benzothiazol-2-yl)ethanol (CAS 1315365-71-9) is a chemical compound with the molecular formula C9H8ClNOS and a molecular weight of 213.68 g/mol. IUPAC name: 1-(5-chloro-1,3-benzothiazol-2-yl)ethanol. InChIKey: CMMKHCAPOXMULI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNOS |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 1-(5-chloro-1,3-benzothiazol-2-yl)ethanol |
| InChIKey | CMMKHCAPOXMULI-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(S1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)