CAS 1029773-61-2 appears in our catalog under these names: 2-(2-Benzyl-4-chlorophenoxy)ethanamine hydrochloride, 97%, [2-(2-Benzyl-4-chlorophenoxy)ethyl]amine hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2-benzyl-4-chlorophenoxy)ethanamine;hydrochloride (CAS 1029773-61-2) is a chemical compound with the molecular formula C15H17Cl2NO and a molecular weight of 298.2 g/mol. IUPAC name: 2-(2-benzyl-4-chlorophenoxy)ethanamine;hydrochloride. InChIKey: BMTBQYDTCVRFER-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 2-(2-benzyl-4-chlorophenoxy)ethanamine;hydrochloride |
| InChIKey | BMTBQYDTCVRFER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=CC(=C2)Cl)OCCN.Cl |
Computed by PubChem (NCBI)