CAS 1423028-97-0 is the registry number for (3-Chlorophenyl)(4-ethoxyphenyl)methanamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(3-chlorophenyl)-(4-ethoxyphenyl)methanamine;hydrochloride (CAS 1423028-97-0) is a chemical compound with the molecular formula C15H17Cl2NO and a molecular weight of 298.2 g/mol. IUPAC name: (3-chlorophenyl)-(4-ethoxyphenyl)methanamine;hydrochloride. InChIKey: LISIDUQLUBCGGK-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | (3-chlorophenyl)-(4-ethoxyphenyl)methanamine;hydrochloride |
| InChIKey | LISIDUQLUBCGGK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)