Products 2089258-30-8
CAS 2089258-30-8 is the registry number for (5-Chloro-2-(3,4-dimethylphenoxy)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[5-chloro-2-(3,4-dimethylphenoxy)phenyl]methanamine;hydrochloride (CAS 2089258-30-8) is a chemical compound with the molecular formula C15H17Cl2NO and a molecular weight of 298.2 g/mol. IUPAC name: [5-chloro-2-(3,4-dimethylphenoxy)phenyl]methanamine;hydrochloride. InChIKey: JSVOUVRXZJKSHP-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | [5-chloro-2-(3,4-dimethylphenoxy)phenyl]methanamine;hydrochloride |
| InChIKey | JSVOUVRXZJKSHP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=C(C=C(C=C2)Cl)CN)C.Cl |
Computed by PubChem (NCBI)