Products 1261776-35-5
CAS 1261776-35-5 is the registry number for 3-(Difluoromethoxy)-5-fluorobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(difluoromethoxy)-5-fluorobenzenesulfonyl chloride (CAS 1261776-35-5) is a chemical compound with the molecular formula C7H4ClF3O3S and a molecular weight of 260.62 g/mol. IUPAC name: 3-(difluoromethoxy)-5-fluorobenzenesulfonyl chloride. InChIKey: BVQUOGYVCGCDOX-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O3S |
|---|---|
| Molecular weight | 260.62 g/mol |
| IUPAC name | 3-(difluoromethoxy)-5-fluorobenzenesulfonyl chloride |
| InChIKey | BVQUOGYVCGCDOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)Cl)OC(F)F |
Computed by PubChem (NCBI)