CAS 103008-52-2 appears in our catalog under these names: 2-(Dimethylsulfamoyl)benzene-1-sulfonyl chloride, 2-(Dimethylsulfamoyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-(dimethylsulfamoyl)benzenesulfonyl chloride (CAS 103008-52-2) is a chemical compound with the molecular formula C8H10ClNO4S2 and a molecular weight of 283.8 g/mol. IUPAC name: 2-(dimethylsulfamoyl)benzenesulfonyl chloride. InChIKey: FNMSCHBHAKRZMZ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4S2 |
|---|---|
| Molecular weight | 283.8 g/mol |
| IUPAC name | 2-(dimethylsulfamoyl)benzenesulfonyl chloride |
| InChIKey | FNMSCHBHAKRZMZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)