CAS 1599801-52-1 is the registry number for Methyl N-{2-(5-(chlorosulfonyl)thiophen-2-yl)ethyl}carbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl N-[2-(5-chlorosulfonylthiophen-2-yl)ethyl]carbamate (CAS 1599801-52-1) is a chemical compound with the molecular formula C8H10ClNO4S2 and a molecular weight of 283.8 g/mol. IUPAC name: methyl N-[2-(5-chlorosulfonylthiophen-2-yl)ethyl]carbamate. InChIKey: TWRZHJIFWONYRV-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4S2 |
|---|---|
| Molecular weight | 283.8 g/mol |
| IUPAC name | methyl N-[2-(5-chlorosulfonylthiophen-2-yl)ethyl]carbamate |
| InChIKey | TWRZHJIFWONYRV-UHFFFAOYSA-N |
| SMILES | COC(=O)NCCC1=CC=C(S1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)