Products 1384430-74-3

CAS 1384430-74-3 appears in our catalog under these names: 2-Benzenesulfonamidoethane-1-sulfonyl chloride, 95%, 2-Benzenesulfonamidoethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-(benzenesulfonamido)ethanesulfonyl chloride (CAS 1384430-74-3) is a chemical compound with the molecular formula C8H10ClNO4S2 and a molecular weight of 283.8 g/mol. IUPAC name: 2-(benzenesulfonamido)ethanesulfonyl chloride. InChIKey: ANWLSTPEYWXYGN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO4S2
Molecular weight283.8 g/mol
IUPAC name2-(benzenesulfonamido)ethanesulfonyl chloride
InChIKeyANWLSTPEYWXYGN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)NCCS(=O)(=O)Cl

Computed by PubChem (NCBI)