Products 197891-83-1

CAS 197891-83-1 appears in our catalog under these names: 3-(dimethylsulfamoyl)benzene-1-sulfonyl chloride, 3-(N,n-dimethylsulfamoyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.

3-(dimethylsulfamoyl)benzenesulfonyl chloride (CAS 197891-83-1) is a chemical compound with the molecular formula C8H10ClNO4S2 and a molecular weight of 283.8 g/mol. IUPAC name: 3-(dimethylsulfamoyl)benzenesulfonyl chloride. InChIKey: PERNYULRLSCWLU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO4S2
Molecular weight283.8 g/mol
IUPAC name3-(dimethylsulfamoyl)benzenesulfonyl chloride
InChIKeyPERNYULRLSCWLU-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)