Products 103008-53-3

CAS 103008-53-3 is the registry number for 2-((Methylsulfonyl)methyl)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(methylsulfonylmethyl)benzenesulfonyl chloride (CAS 103008-53-3) is a chemical compound with the molecular formula C8H9ClO4S2 and a molecular weight of 268.7 g/mol. IUPAC name: 2-(methylsulfonylmethyl)benzenesulfonyl chloride. InChIKey: DOHHRONYRJYSGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO4S2
Molecular weight268.7 g/mol
IUPAC name2-(methylsulfonylmethyl)benzenesulfonyl chloride
InChIKeyDOHHRONYRJYSGZ-UHFFFAOYSA-N
SMILESCS(=O)(=O)CC1=CC=CC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)