CAS 2224-67-1 appears in our catalog under these names: 5-Methanesulfonyl-2-methylbenzene-1-sulfonyl chloride, 95%, 5-Methanesulfonyl-2-methyl-benzenesulfonylchloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
2-methyl-5-methylsulfonylbenzenesulfonyl chloride (CAS 2224-67-1) is a chemical compound with the molecular formula C8H9ClO4S2 and a molecular weight of 268.7 g/mol. IUPAC name: 2-methyl-5-methylsulfonylbenzenesulfonyl chloride. InChIKey: UAPXGQGQLFOWOC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO4S2 |
|---|---|
| Molecular weight | 268.7 g/mol |
| IUPAC name | 2-methyl-5-methylsulfonylbenzenesulfonyl chloride |
| InChIKey | UAPXGQGQLFOWOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)