Products 64440-81-9

CAS 64440-81-9 appears in our catalog under these names: 2-(Benzenesulfonyl)ethane-1-sulfonyl chloride, 95%, 2-(Benzenesulfonyl)ethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(benzenesulfonyl)ethanesulfonyl chloride (CAS 64440-81-9) is a chemical compound with the molecular formula C8H9ClO4S2 and a molecular weight of 268.7 g/mol. IUPAC name: 2-(benzenesulfonyl)ethanesulfonyl chloride. InChIKey: DEGAJMGMZJLZPT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO4S2
Molecular weight268.7 g/mol
IUPAC name2-(benzenesulfonyl)ethanesulfonyl chloride
InChIKeyDEGAJMGMZJLZPT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)