CAS 103011-95-6 is the registry number for (E)-Ethyl 2-cyano-3-(pyridin-3-yl)acrylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl (E)-2-cyano-3-pyridin-3-ylprop-2-enoate (CAS 103011-95-6) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: ethyl (E)-2-cyano-3-pyridin-3-ylprop-2-enoate. InChIKey: BMMBXBIFKMYOLF-UXBLZVDNSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-pyridin-3-ylprop-2-enoate |
| InChIKey | BMMBXBIFKMYOLF-UXBLZVDNSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CN=CC=C1)/C#N |
Computed by PubChem (NCBI)