CAS 103027-70-9 is the registry number for 3-(4-Chlorobenzyl)thiazolidine-2,4-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (CAS 103027-70-9) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: SEARMTYHHPFOCL-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | SEARMTYHHPFOCL-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)