CAS 103028-54-2 is the registry number for 5-Chloronaphthalen-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloronaphthalen-2-amine (CAS 103028-54-2) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 5-chloronaphthalen-2-amine. InChIKey: BJKRBSSSWLPJPS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 5-chloronaphthalen-2-amine |
| InChIKey | BJKRBSSSWLPJPS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C(=C1)Cl |
Computed by PubChem (NCBI)