Products 1030419-79-4
CAS 1030419-79-4 is the registry number for Ethyl 7-amino-2-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 7-amino-2-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (CAS 1030419-79-4) is a chemical compound with the molecular formula C10H13N5O3 and a molecular weight of 251.24 g/mol. IUPAC name: ethyl 7-amino-2-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: YRIVFAMZCVAPBA-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | ethyl 7-amino-2-(methoxymethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | YRIVFAMZCVAPBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C(=NC(=N2)COC)N=C1)N |
Computed by PubChem (NCBI)