Products 1030453-35-0
CAS 1030453-35-0 is the registry number for 7-(2-Furyl)-2-methyl-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-(furan-2-yl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 1030453-35-0) is a chemical compound with the molecular formula C11H10N4O3 and a molecular weight of 246.22 g/mol. IUPAC name: 7-(furan-2-yl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: ZWIZRQWXHDAFCB-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O3 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 7-(furan-2-yl)-2-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | ZWIZRQWXHDAFCB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(C=C(NC2=N1)C(=O)O)C3=CC=CO3 |
Computed by PubChem (NCBI)