CAS 835876-10-3 is the registry number for 2'-Methoxy-5-nitro-(3,3'-bipyridin)-6-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
5-(2-methoxy-3-pyridinyl)-3-nitropyridin-2-amine (CAS 835876-10-3) is a chemical compound with the molecular formula C11H10N4O3 and a molecular weight of 246.22 g/mol. IUPAC name: 5-(2-methoxy-3-pyridinyl)-3-nitropyridin-2-amine. InChIKey: IRKUWPMGYPRVAH-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O3 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 5-(2-methoxy-3-pyridinyl)-3-nitropyridin-2-amine |
| InChIKey | IRKUWPMGYPRVAH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=N1)C2=CC(=C(N=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)