Products 835876-09-0

CAS 835876-09-0 is the registry number for 6'-Methoxy-5-nitro(3,3')bipyridinyl-6-ylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

5-(6-methoxy-3-pyridinyl)-3-nitropyridin-2-amine (CAS 835876-09-0) is a chemical compound with the molecular formula C11H10N4O3 and a molecular weight of 246.22 g/mol. IUPAC name: 5-(6-methoxy-3-pyridinyl)-3-nitropyridin-2-amine. InChIKey: NSZOQZYKDXLCCX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N4O3
Molecular weight246.22 g/mol
IUPAC name5-(6-methoxy-3-pyridinyl)-3-nitropyridin-2-amine
InChIKeyNSZOQZYKDXLCCX-UHFFFAOYSA-N
SMILESCOC1=NC=C(C=C1)C2=CC(=C(N=C2)N)[N+](=O)[O-]

Computed by PubChem (NCBI)