CAS 1030508-04-3 appears in our catalog under these names: 4-Chloro-3-(4-methoxybenzamido)benzoic acid, 4-Chloro-3-(4-methoxybenzamido)benzoic acid, 95%, 4-Chloro-3-[(4-methoxybenzene)amido]benzoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg, 100mg.
4-chloro-3-[(4-methoxybenzoyl)amino]benzoic acid (CAS 1030508-04-3) is a chemical compound with the molecular formula C15H12ClNO4 and a molecular weight of 305.71 g/mol. IUPAC name: 4-chloro-3-[(4-methoxybenzoyl)amino]benzoic acid. InChIKey: OCJQMYKXVFRIFV-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4 |
|---|---|
| Molecular weight | 305.71 g/mol |
| IUPAC name | 4-chloro-3-[(4-methoxybenzoyl)amino]benzoic acid |
| InChIKey | OCJQMYKXVFRIFV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)