Products 69764-05-2
CAS 69764-05-2 is the registry number for 4-Chloro-2-(2-phenoxyacetamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-chloro-2-[(2-phenoxyacetyl)amino]benzoic acid (CAS 69764-05-2) is a chemical compound with the molecular formula C15H12ClNO4 and a molecular weight of 305.71 g/mol. IUPAC name: 4-chloro-2-[(2-phenoxyacetyl)amino]benzoic acid. InChIKey: GLZGWOIWRBJXCZ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4 |
|---|---|
| Molecular weight | 305.71 g/mol |
| IUPAC name | 4-chloro-2-[(2-phenoxyacetyl)amino]benzoic acid |
| InChIKey | GLZGWOIWRBJXCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)NC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)