CAS 871266-45-4 appears in our catalog under these names: Formoterol Impurity 71, 2-CHLORO-1-[3-NITRO-4-(PHENYLMETHOXY)PHENYL]ETHANONE, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 100mg, 250mg, 500mg.
2-chloro-1-(3-nitro-4-phenylmethoxyphenyl)ethanone (CAS 871266-45-4) is a chemical compound with the molecular formula C15H12ClNO4 and a molecular weight of 305.71 g/mol. IUPAC name: 2-chloro-1-(3-nitro-4-phenylmethoxyphenyl)ethanone. InChIKey: QPYUECMDRCUGMZ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO4 |
|---|---|
| Molecular weight | 305.71 g/mol |
| IUPAC name | 2-chloro-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
| InChIKey | QPYUECMDRCUGMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)