Products 1030605-63-0

CAS 1030605-63-0 is the registry number for 5-[(3,5-Dimethyl-1h-pyrazol-4-yl)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid (CAS 1030605-63-0) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid. InChIKey: NPBZTOKSEXKKAG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O3
Molecular weight220.22 g/mol
IUPAC name5-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]furan-2-carboxylic acid
InChIKeyNPBZTOKSEXKKAG-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)C)CC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)