CAS 103068-18-4 is the registry number for 3–Biphenylmagnesium bromide. Offered by: GLPBio. Available pack sizes: 100ml, 25ml, 500ml.
Magnesium;phenylbenzene;bromide (CAS 103068-18-4) is a chemical compound with the molecular formula C12H9BrMg and a molecular weight of 257.41 g/mol. IUPAC name: magnesium;phenylbenzene;bromide. InChIKey: SRNAAWKKVXHYTI-UHFFFAOYSA-M.
| Molecular formula | C12H9BrMg |
|---|---|
| Molecular weight | 257.41 g/mol |
| IUPAC name | magnesium;phenylbenzene;bromide |
| InChIKey | SRNAAWKKVXHYTI-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C[C-]=C2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)