CAS 3315-91-1 appears in our catalog under these names: 4–Biphenylmagnesium bromide, 4-BIPHENYLMAGNESIUM BROMIDE, 0.5M SOLUT&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 500ml, 50ML.
Magnesium;phenylbenzene;bromide (CAS 3315-91-1) is a chemical compound with the molecular formula C12H9BrMg and a molecular weight of 257.41 g/mol. IUPAC name: magnesium;phenylbenzene;bromide. InChIKey: JWQLJPBJNSPKSG-UHFFFAOYSA-M.
| Molecular formula | C12H9BrMg |
|---|---|
| Molecular weight | 257.41 g/mol |
| IUPAC name | magnesium;phenylbenzene;bromide |
| InChIKey | JWQLJPBJNSPKSG-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=[C-]C=C2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)