CAS 82214-69-5 is the registry number for 2-BIPHENYLYLMAGNESIUM BROMIDE, 0.5M IN &. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Magnesium;phenylbenzene;bromide (CAS 82214-69-5) is a chemical compound with the molecular formula C12H9BrMg and a molecular weight of 257.41 g/mol. IUPAC name: magnesium;phenylbenzene;bromide. InChIKey: BQVOYNVIWKWAIN-UHFFFAOYSA-M.
| Molecular formula | C12H9BrMg |
|---|---|
| Molecular weight | 257.41 g/mol |
| IUPAC name | magnesium;phenylbenzene;bromide |
| InChIKey | BQVOYNVIWKWAIN-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=[C-]2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)