CAS 1030832-26-8 appears in our catalog under these names: 2-Bromomethyl-4-cyanophenylboronic acid pinacol ester, 96%, 3-(Bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1030832-26-8) is a chemical compound with the molecular formula C14H17BBrNO2 and a molecular weight of 322.01 g/mol. IUPAC name: 3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: LHTGMALCZBIYGJ-UHFFFAOYSA-N.
| Molecular formula | C14H17BBrNO2 |
|---|---|
| Molecular weight | 322.01 g/mol |
| IUPAC name | 3-(bromomethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | LHTGMALCZBIYGJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)CBr |
Computed by PubChem (NCBI)