CAS 1219637-80-5 is the registry number for 5-Bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1219637-80-5) is a chemical compound with the molecular formula C14H17BBrNO2 and a molecular weight of 322.01 g/mol. IUPAC name: 5-bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: XSLCNVSLHIGMRI-UHFFFAOYSA-N.
| Molecular formula | C14H17BBrNO2 |
|---|---|
| Molecular weight | 322.01 g/mol |
| IUPAC name | 5-bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | XSLCNVSLHIGMRI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2NC=C3)Br |
Computed by PubChem (NCBI)