CAS 1256358-97-0 appears in our catalog under these names: 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%, 97%, 4-Bromo-1h-indole-2-boronic acid pinacol ester, 97%, 4-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 97%. Offered by: Chemat, Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1256358-97-0) is a chemical compound with the molecular formula C14H17BBrNO2 and a molecular weight of 322.01 g/mol. IUPAC name: 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: LAQMOXKWQOAHNA-UHFFFAOYSA-N.
| Molecular formula | C14H17BBrNO2 |
|---|---|
| Molecular weight | 322.01 g/mol |
| IUPAC name | 4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | LAQMOXKWQOAHNA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2)C=CC=C3Br |
Computed by PubChem (NCBI)