CAS 1031130-62-7 appears in our catalog under these names: 4-{(2-(thiophen-2-yl)ethyl)sulfamoyl}benzoic acid, 95%, 4-{(2-(Thiophen-2-yl)ethyl)sulfamoyl}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-(2-thiophen-2-ylethylsulfamoyl)benzoic acid (CAS 1031130-62-7) is a chemical compound with the molecular formula C13H13NO4S2 and a molecular weight of 311.4 g/mol. IUPAC name: 4-(2-thiophen-2-ylethylsulfamoyl)benzoic acid. InChIKey: YAGWDFOAVUUGTC-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 4-(2-thiophen-2-ylethylsulfamoyl)benzoic acid |
| InChIKey | YAGWDFOAVUUGTC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CCNS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)