Products 1153392-73-4

CAS 1153392-73-4 is the registry number for 3-([(3,4-Dimethylphenyl)sulfonyl]amino)thiophene-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid (CAS 1153392-73-4) is a chemical compound with the molecular formula C13H13NO4S2 and a molecular weight of 311.4 g/mol. IUPAC name: 3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid. InChIKey: VPPNBUNUYFFNOR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4S2
Molecular weight311.4 g/mol
IUPAC name3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid
InChIKeyVPPNBUNUYFFNOR-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C(=O)O)C

Computed by PubChem (NCBI)