CAS 1153392-73-4 is the registry number for 3-([(3,4-Dimethylphenyl)sulfonyl]amino)thiophene-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid (CAS 1153392-73-4) is a chemical compound with the molecular formula C13H13NO4S2 and a molecular weight of 311.4 g/mol. IUPAC name: 3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid. InChIKey: VPPNBUNUYFFNOR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 3-[(3,4-dimethylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
| InChIKey | VPPNBUNUYFFNOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC2=C(SC=C2)C(=O)O)C |
Computed by PubChem (NCBI)