CAS 140947-38-2 is the registry number for Methyl 3-([methyl(phenyl)amino]sulfonyl)thiophene-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxylate (CAS 140947-38-2) is a chemical compound with the molecular formula C13H13NO4S2 and a molecular weight of 311.4 g/mol. IUPAC name: methyl 3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxylate. InChIKey: JQDASXSFEYTFLI-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | methyl 3-[methyl(phenyl)sulfamoyl]thiophene-2-carboxylate |
| InChIKey | JQDASXSFEYTFLI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)S(=O)(=O)C2=C(SC=C2)C(=O)OC |
Computed by PubChem (NCBI)