Products 10314-35-9

CAS 10314-35-9 appears in our catalog under these names: Cyclohexylsulfamoyl chloride, 98%, Cyclohexylsulfamoyl Chloride, N-cyclohexylsulfamoyl chloride, 95%+, 95%+, CYCLOHEXYLSULFAMOYL CHLORIDE, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

N-cyclohexylsulfamoyl chloride (CAS 10314-35-9) is a chemical compound with the molecular formula C6H12ClNO2S and a molecular weight of 197.68 g/mol. IUPAC name: N-cyclohexylsulfamoyl chloride. InChIKey: FGZSEUXOFDMNEL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2S
Molecular weight197.68 g/mol
IUPAC nameN-cyclohexylsulfamoyl chloride
InChIKeyFGZSEUXOFDMNEL-UHFFFAOYSA-N
SMILESC1CCC(CC1)NS(=O)(=O)Cl

Computed by PubChem (NCBI)