CAS 2231666-33-2 is the registry number for Methyl (2s,4r)-4-sulfanylpyrrolidine-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride (CAS 2231666-33-2) is a chemical compound with the molecular formula C6H12ClNO2S and a molecular weight of 197.68 g/mol. IUPAC name: methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: FRPQUTPXKLXQNI-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2S |
|---|---|
| Molecular weight | 197.68 g/mol |
| IUPAC name | methyl (2S,4R)-4-sulfanylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | FRPQUTPXKLXQNI-JBUOLDKXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1)S.Cl |
Computed by PubChem (NCBI)